C25H30N2O4 — CID 55583981
N-[4-[1-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 55583981) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[4-[1-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55583981 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[4-[1-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NC(C)c2ccc(NC(=O)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-3-16-31-22-12-8-19(9-13-22)23(28)14-15-24(29)26-17(2)18-6-10-21(11-7-18)27-25(30)20-4-5-20/h6-13,17,20H,3-5,14-16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | SRIDQYAUPQWJKO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |