C21H30N2O3Si — CID 153437653
ethyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]-3-cyano-3-isocyano-2-methylpropanoate (PubChem CID 153437653) has the molecular formula C21H30N2O3Si and a molecular weight of 386.57 g/mol. Its IUPAC name is ethyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]-3-cyano-3-isocyano-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]-3-cyano-3-isocyano-2-methylpropanoate |
|---|---|
| PubChem CID | 153437653 |
| Molecular Formula | C21H30N2O3Si |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethyl 2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]-3-cyano-3-isocyano-2-methylpropanoate |
| SMILES | [C-]#[N+]C(C#N)C(C)(C(=O)OCC)c1ccc(O[Si](C)(C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C21H30N2O3Si/c1-10-25-19(24)21(6,18(14-22)23-7)16-11-12-17(15(2)13-16)26-27(8,9)20(3,4)5/h11-13,18H,10H2,1-6,8-9H3 |
| InChIKey | ZSNMWPDLALGKIO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|