C32H48O2Si — CID 87193201
5-[4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-5-methylhex-1-yn-3-ol (PubChem CID 87193201) has the molecular formula C32H48O2Si and a molecular weight of 492.82 g/mol. Its IUPAC name is 5-[4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-5-methylhex-1-yn-3-ol.
| Compound Name | 5-[4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-5-methylhex-1-yn-3-ol |
|---|---|
| PubChem CID | 87193201 |
| Molecular Formula | C32H48O2Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | 5-[4-[3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-5-methylhex-1-yn-3-ol |
| SMILES | C#CC(O)CC(C)(C)c1ccc(C(CC)(CC)c2ccc(O[Si](C)(C)C(C)(C)C)c(C)c2)cc1C |
| InChI | InChI=1S/C32H48O2Si/c1-13-27(33)22-31(9,10)28-18-16-25(20-23(28)4)32(14-2,15-3)26-17-19-29(24(5)21-26)34-35(11,12)30(6,7)8/h1,16-21,27,33H,14-15,22H2,2-12H3 |
| InChIKey | AQQXAKZEBGGXSI-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|