C30H50O6Si — CID 161115589
3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]pentan-3-ol;4-(3-hydroxypentan-3-yl)-2-methoxyphenol (PubChem CID 161115589) has the molecular formula C30H50O6Si and a molecular weight of 534.81 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]pentan-3-ol;4-(3-hydroxypentan-3-yl)-2-methoxyphenol.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]pentan-3-ol;4-(3-hydroxypentan-3-yl)-2-methoxyphenol |
|---|---|
| PubChem CID | 161115589 |
| Molecular Formula | C30H50O6Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]pentan-3-ol;4-(3-hydroxypentan-3-yl)-2-methoxyphenol |
| SMILES | CCC(O)(CC)c1ccc(O)c(OC)c1.CCC(O)(CC)c1ccc(O[Si](C)(C)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H32O3Si.C12H18O3/c1-9-18(19,10-2)14-11-12-15(16(13-14)20-6)21-22(7,8)17(3,4)5;1-4-12(14,5-2)9-6-7-10(13)11(8-9)15-3/h11-13,19H,9-10H2,1-8H3;6-8,13-14H,4-5H2,1-3H3 |
| InChIKey | UKGUOQSBILJYCU-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|