About [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate
[4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate (PubChem CID 175601308) has the molecular formula C15H17FN4O2
and a molecular weight of 304.33 g/mol. Its IUPAC name is [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate.
Molecular Properties
| Compound Name | [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate |
| PubChem CID | 175601308 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate |
| SMILES | Cc1cc(-c2ncnc(C(C)(C)C)n2)c(F)cc1OC(N)=O |
| InChI | InChI=1S/C15H17FN4O2/c1-8-5-9(10(16)6-11(8)22-14(17)21)12-18-7-19-13(20-12)15(2,3)4/h5-7H,1-4H3,(H2,17,21) |
| InChIKey | NDGQSKXWTWOVJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate?
The IUPAC name of [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate (CID 175601308) is [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate.
What is the SMILES notation for [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate?
The canonical SMILES for [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate is Cc1cc(-c2ncnc(C(C)(C)C)n2)c(F)cc1OC(N)=O.
What is the InChIKey of [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate?
The InChIKey is NDGQSKXWTWOVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4O2/c1-8-5-9(10(16)6-11(8)22-14(17)21)12-18-7-19-13(20-12)15(2,3)4/h5-7H,1-4H3,(H2,17,21).
What are the key properties of [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate?
[4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate has a molecular weight of 304.33 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-tert-butyl-1,3,5-triazin-2-yl)-5-fluoro-2-methylphenyl] carbamate is sourced from PubChem (CID 175601308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).