C19H24FNO3 — CID 162109514
(6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) 2-ethoxyacetate (PubChem CID 162109514) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) 2-ethoxyacetate.
| Compound Name | (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) 2-ethoxyacetate |
|---|---|
| PubChem CID | 162109514 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) 2-ethoxyacetate |
| SMILES | CCOCC(=O)Oc1c(C)c(C)nc2c(F)cc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C19H24FNO3/c1-7-23-10-16(22)24-18-11(2)12(3)21-17-14(18)8-13(9-15(17)20)19(4,5)6/h8-9H,7,10H2,1-6H3 |
| InChIKey | ZFYQUFZXIRSQGY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |