C10H9BrF2O2 — CID 115782966
1-(4-bromo-2,6-difluorophenyl)-2-ethoxyethanone (PubChem CID 115782966) has the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-ethoxyethanone.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-ethoxyethanone |
|---|---|
| PubChem CID | 115782966 |
| Molecular Formula | C10H9BrF2O2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-ethoxyethanone |
| SMILES | CCOCC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H9BrF2O2/c1-2-15-5-9(14)10-7(12)3-6(11)4-8(10)13/h3-4H,2,5H2,1H3 |
| InChIKey | VGKCZGHIYXIBHY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |