C11H16O3 — CID 115783034
2-ethoxy-1-(2,4,5-trimethylfuran-3-yl)ethanone (PubChem CID 115783034) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-ethoxy-1-(2,4,5-trimethylfuran-3-yl)ethanone.
| Compound Name | 2-ethoxy-1-(2,4,5-trimethylfuran-3-yl)ethanone |
|---|---|
| PubChem CID | 115783034 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-ethoxy-1-(2,4,5-trimethylfuran-3-yl)ethanone |
| SMILES | CCOCC(=O)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C11H16O3/c1-5-13-6-10(12)11-7(2)8(3)14-9(11)4/h5-6H2,1-4H3 |
| InChIKey | JLZZHXMCVNZXQN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |