C12H18O4 — CID 78832560
2-ethoxyethyl 2,4,5-trimethylfuran-3-carboxylate (PubChem CID 78832560) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-ethoxyethyl 2,4,5-trimethylfuran-3-carboxylate.
| Compound Name | 2-ethoxyethyl 2,4,5-trimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 78832560 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-ethoxyethyl 2,4,5-trimethylfuran-3-carboxylate |
| SMILES | CCOCCOC(=O)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C12H18O4/c1-5-14-6-7-15-12(13)11-8(2)9(3)16-10(11)4/h5-7H2,1-4H3 |
| InChIKey | XVBIKMOTCHMXKW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|