C13H16BrFO3 — CID 177064336
1-(4-bromo-2-fluoro-6-methylphenyl)-2,2-diethoxyethanone (PubChem CID 177064336) has the molecular formula C13H16BrFO3 and a molecular weight of 319.17 g/mol. Its IUPAC name is 1-(4-bromo-2-fluoro-6-methylphenyl)-2,2-diethoxyethanone.
| Compound Name | 1-(4-bromo-2-fluoro-6-methylphenyl)-2,2-diethoxyethanone |
|---|---|
| PubChem CID | 177064336 |
| Molecular Formula | C13H16BrFO3 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(4-bromo-2-fluoro-6-methylphenyl)-2,2-diethoxyethanone |
| SMILES | CCOC(OCC)C(=O)c1c(C)cc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFO3/c1-4-17-13(18-5-2)12(16)11-8(3)6-9(14)7-10(11)15/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | WIUSQDRVXOPAIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|