C14H16BrFO4 — CID 82967020
1-(4-bromo-2-fluorophenyl)-4,4-diethoxybutane-1,3-dione (PubChem CID 82967020) has the molecular formula C14H16BrFO4 and a molecular weight of 347.18 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-4,4-diethoxybutane-1,3-dione.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-4,4-diethoxybutane-1,3-dione |
|---|---|
| PubChem CID | 82967020 |
| Molecular Formula | C14H16BrFO4 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-4,4-diethoxybutane-1,3-dione |
| SMILES | CCOC(OCC)C(=O)CC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C14H16BrFO4/c1-3-19-14(20-4-2)13(18)8-12(17)10-6-5-9(15)7-11(10)16/h5-7,14H,3-4,8H2,1-2H3 |
| InChIKey | MIXFUZRYWPJWEK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|