C11H13BrFNO3 — CID 118924355
1-(2-bromo-5-fluoro-4-pyridinyl)-2,2-diethoxyethanone (PubChem CID 118924355) has the molecular formula C11H13BrFNO3 and a molecular weight of 306.13 g/mol. Its IUPAC name is 1-(2-bromo-5-fluoro-4-pyridinyl)-2,2-diethoxyethanone.
| Compound Name | 1-(2-bromo-5-fluoro-4-pyridinyl)-2,2-diethoxyethanone |
|---|---|
| PubChem CID | 118924355 |
| Molecular Formula | C11H13BrFNO3 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1-(2-bromo-5-fluoro-4-pyridinyl)-2,2-diethoxyethanone |
| SMILES | CCOC(OCC)C(=O)c1cc(Br)ncc1F |
| InChI | InChI=1S/C11H13BrFNO3/c1-3-16-11(17-4-2)10(15)7-5-9(12)14-6-8(7)13/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | HGFCRNWKATWDGH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|