C12H14BrClO — CID 146011121
1-(4-bromo-2,6-dimethylphenyl)-2-chlorobutan-1-one (PubChem CID 146011121) has the molecular formula C12H14BrClO and a molecular weight of 289.60 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-2-chlorobutan-1-one.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-2-chlorobutan-1-one |
|---|---|
| PubChem CID | 146011121 |
| Molecular Formula | C12H14BrClO |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-2-chlorobutan-1-one |
| SMILES | CCC(Cl)C(=O)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C12H14BrClO/c1-4-10(14)12(15)11-7(2)5-9(13)6-8(11)3/h5-6,10H,4H2,1-3H3 |
| InChIKey | DXEDJCTUFZSMIV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|