C12H13BrO — CID 130137103
1-(4-bromo-2,6-dimethylphenyl)-2-methylprop-2-en-1-one (PubChem CID 130137103) has the molecular formula C12H13BrO and a molecular weight of 253.14 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-2-methylprop-2-en-1-one.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 130137103 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C12H13BrO/c1-7(2)12(14)11-8(3)5-10(13)6-9(11)4/h5-6H,1H2,2-4H3 |
| InChIKey | KTRALYCKLCGCSR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|