About benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate
benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate (PubChem CID 134691545) has the molecular formula C23H24FNO3
and a molecular weight of 381.45 g/mol. Its IUPAC name is benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate.
Analyze benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate?
The IUPAC name of benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate (CID 134691545) is benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate.
What is the SMILES notation for benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate?
The canonical SMILES for benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate is Cc1nc2c(F)cc(C(C)(C)C)cc2c(OC(=O)OCc2ccccc2)c1C.
What is the InChIKey of benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate?
The InChIKey is QFPOKIYOZDDHRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FNO3/c1-14-15(2)25-20-18(11-17(12-19(20)24)23(3,4)5)21(14)28-22(26)27-13-16-9-7-6-8-10-16/h6-12H,13H2,1-5H3.
What are the key properties of benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate?
benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate has a molecular weight of 381.45 g/mol, XLogP of 6.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) carbonate is sourced from PubChem (CID 134691545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).