C18H16FN3O2 — CID 51086110
7-fluoro-2,3-dimethyl-N-phenylmethoxyquinoxaline-5-carboxamide (PubChem CID 51086110) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-N-phenylmethoxyquinoxaline-5-carboxamide.
| Compound Name | 7-fluoro-2,3-dimethyl-N-phenylmethoxyquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 51086110 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-N-phenylmethoxyquinoxaline-5-carboxamide |
| SMILES | Cc1nc2cc(F)cc(C(=O)NOCc3ccccc3)c2nc1C |
| InChI | InChI=1S/C18H16FN3O2/c1-11-12(2)21-17-15(8-14(19)9-16(17)20-11)18(23)22-24-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,22,23) |
| InChIKey | LUVNYIUZUHYTQF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|