C14H15NO2S — CID 32581114
4,5-dimethyl-N-phenylmethoxythiophene-2-carboxamide (PubChem CID 32581114) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4,5-dimethyl-N-phenylmethoxythiophene-2-carboxamide.
| Compound Name | 4,5-dimethyl-N-phenylmethoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 32581114 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4,5-dimethyl-N-phenylmethoxythiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NOCc2ccccc2)sc1C |
| InChI | InChI=1S/C14H15NO2S/c1-10-8-13(18-11(10)2)14(16)15-17-9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | WEUJQZNKRFQBFB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|