C21H18FN3O2S — CID 26179859
1-[(4-fluorophenyl)methyl]-3-methyl-N-phenylmethoxythieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 26179859) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-methyl-N-phenylmethoxythieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-methyl-N-phenylmethoxythieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 26179859 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-methyl-N-phenylmethoxythieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c2sc(C(=O)NOCc3ccccc3)cc12 |
| InChI | InChI=1S/C21H18FN3O2S/c1-14-18-11-19(20(26)24-27-13-16-5-3-2-4-6-16)28-21(18)25(23-14)12-15-7-9-17(22)10-8-15/h2-11H,12-13H2,1H3,(H,24,26) |
| InChIKey | YDQJWGYTOXUFBN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|