C23H22N4O2S — CID 24659947
N-(2-benzamidoethyl)-1-benzyl-3-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 24659947) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-1-benzyl-3-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-1-benzyl-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 24659947 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-(2-benzamidoethyl)-1-benzyl-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c2sc(C(=O)NCCNC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C23H22N4O2S/c1-16-19-14-20(30-23(19)27(26-16)15-17-8-4-2-5-9-17)22(29)25-13-12-24-21(28)18-10-6-3-7-11-18/h2-11,14H,12-13,15H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | LRRVILTURDQDJA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|