C39H37FN4O7 — CID 11629001
(6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) acetate;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate (PubChem CID 11629001) has the molecular formula C39H37FN4O7 and a molecular weight of 692.74 g/mol. Its IUPAC name is (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) acetate;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate.
| Compound Name | (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) acetate;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 11629001 |
| Molecular Formula | C39H37FN4O7 |
| Molecular Weight | 692.74 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | (6-tert-butyl-8-fluoro-2,3-dimethylquinolin-4-yl) acetate;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
| SMILES | CC(=O)Oc1c(C)c(C)nc2c(F)cc(C(C)(C)C)cc12.CO/C=C(/C(=O)OC)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1 |
| InChI | InChI=1S/C22H17N3O5.C17H20FNO2/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23;1-9-10(2)19-15-13(16(9)21-11(3)20)7-12(8-14(15)18)17(4,5)6/h3-11,13-14H,1-2H3;7-8H,1-6H3/b17-13+; |
| InChIKey | RCQFVEDOZIRVKI-IWSIBTJSSA-N |
| XLogP | 8.31 |
| TPSA | 142.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.74 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|