C36H29Cl2N5O6 — CID 166681090
1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate (PubChem CID 166681090) has the molecular formula C36H29Cl2N5O6 and a molecular weight of 698.56 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate.
| Compound Name | 1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 166681090 |
| Molecular Formula | C36H29Cl2N5O6 |
| Molecular Weight | 698.56 g/mol |
| Exact Mass | 697.15 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-methoxy-2-pyridin-3-ylethanimine;methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1.CON=C(Cc1cccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17N3O5.C14H12Cl2N2O/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23;1-19-18-14(7-10-3-2-6-17-9-10)12-5-4-11(15)8-13(12)16/h3-11,13-14H,1-2H3;2-6,8-9H,7H2,1H3/b17-13+; |
| InChIKey | BETJVFUTSXNFMT-IWSIBTJSSA-N |
| XLogP | 8.07 |
| TPSA | 138.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.56 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|