C21H16N4O4 — CID 177433977
methyl (Z)-3-amino-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]prop-2-enoate (PubChem CID 177433977) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is methyl (Z)-3-amino-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-amino-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 177433977 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | methyl (Z)-3-amino-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C\N)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1 |
| InChI | InChI=1S/C21H16N4O4/c1-27-21(26)16(12-23)15-7-3-5-9-18(15)29-20-10-19(24-13-25-20)28-17-8-4-2-6-14(17)11-22/h2-10,12-13H,23H2,1H3/b16-12- |
| InChIKey | QEOZTBLSRYEJOK-VBKFSLOCSA-N |
| XLogP | 3.41 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|