C22H17N3O4 — CID 91278250
2-[6-[2-(3-methoxy-1-oxobut-1-en-2-yl)phenoxy]pyrimidin-4-yl]oxybenzonitrile (PubChem CID 91278250) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[6-[2-(3-methoxy-1-oxobut-1-en-2-yl)phenoxy]pyrimidin-4-yl]oxybenzonitrile.
| Compound Name | 2-[6-[2-(3-methoxy-1-oxobut-1-en-2-yl)phenoxy]pyrimidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 91278250 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[6-[2-(3-methoxy-1-oxobut-1-en-2-yl)phenoxy]pyrimidin-4-yl]oxybenzonitrile |
| SMILES | COC(C)C(=C=O)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1 |
| InChI | InChI=1S/C22H17N3O4/c1-15(27-2)18(13-26)17-8-4-6-10-20(17)29-22-11-21(24-14-25-22)28-19-9-5-3-7-16(19)12-23/h3-11,14-15H,1-2H3 |
| InChIKey | WDTVOFKPCUHJCY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 94.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|