C15H13ClN2O3 — CID 59887477
methyl (Z)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]but-2-enoate (PubChem CID 59887477) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is methyl (Z)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]but-2-enoate.
| Compound Name | methyl (Z)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]but-2-enoate |
|---|---|
| PubChem CID | 59887477 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl (Z)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]but-2-enoate |
| SMILES | C/C=C(\C(=O)OC)c1ccccc1Oc1cc(Cl)ncn1 |
| InChI | InChI=1S/C15H13ClN2O3/c1-3-10(15(19)20-2)11-6-4-5-7-12(11)21-14-8-13(16)17-9-18-14/h3-9H,1-2H3/b10-3- |
| InChIKey | UHBMCCGRVORVEN-KMKOMSMNSA-N |
| XLogP | 3.50 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|