C19H14ClN3O4 — CID 87445891
(E)-2-[2-[6-[(2-chloro-3-pyridinyl)oxy]pyrimidin-4-yl]oxyphenyl]but-2-enoic acid (PubChem CID 87445891) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is (E)-2-[2-[6-[(2-chloro-3-pyridinyl)oxy]pyrimidin-4-yl]oxyphenyl]but-2-enoic acid.
| Compound Name | (E)-2-[2-[6-[(2-chloro-3-pyridinyl)oxy]pyrimidin-4-yl]oxyphenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 87445891 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (E)-2-[2-[6-[(2-chloro-3-pyridinyl)oxy]pyrimidin-4-yl]oxyphenyl]but-2-enoic acid |
| SMILES | C/C=C(/C(=O)O)c1ccccc1Oc1cc(Oc2cccnc2Cl)ncn1 |
| InChI | InChI=1S/C19H14ClN3O4/c1-2-12(19(24)25)13-6-3-4-7-14(13)26-16-10-17(23-11-22-16)27-15-8-5-9-21-18(15)20/h2-11H,1H3,(H,24,25)/b12-2+ |
| InChIKey | WLZNYCFFMYNMLH-SWGQDTFXSA-N |
| XLogP | 4.60 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|