C31H30Cl2N4O9 — CID 86306085
methyl 2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3,3-dimethoxypropanoate;methyl (E)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3-methoxyprop-2-enoate (PubChem CID 86306085) has the molecular formula C31H30Cl2N4O9 and a molecular weight of 673.51 g/mol. Its IUPAC name is methyl 2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3,3-dimethoxypropanoate;methyl (E)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3,3-dimethoxypropanoate;methyl (E)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 86306085 |
| Molecular Formula | C31H30Cl2N4O9 |
| Molecular Weight | 673.51 g/mol |
| Exact Mass | 672.14 |
| IUPAC Name | methyl 2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3,3-dimethoxypropanoate;methyl (E)-2-[2-(6-chloropyrimidin-4-yl)oxyphenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1Oc1cc(Cl)ncn1.COC(=O)C(c1ccccc1Oc1cc(Cl)ncn1)C(OC)OC |
| InChI | InChI=1S/C16H17ClN2O5.C15H13ClN2O4/c1-21-15(20)14(16(22-2)23-3)10-6-4-5-7-11(10)24-13-8-12(17)18-9-19-13;1-20-8-11(15(19)21-2)10-5-3-4-6-12(10)22-14-7-13(16)17-9-18-14/h4-9,14,16H,1-3H3;3-9H,1-2H3/b;11-8+ |
| InChIKey | HBRUEHUOWLSDKK-IBMQDACXSA-N |
| XLogP | 5.88 |
| TPSA | 150.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|