C20H17N3O5 — CID 54201537
methyl 3-methoxy-2-[2-[(4-phenoxy-1,3,5-triazin-2-yl)oxy]phenyl]prop-2-enoate (PubChem CID 54201537) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-[(4-phenoxy-1,3,5-triazin-2-yl)oxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-[(4-phenoxy-1,3,5-triazin-2-yl)oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54201537 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 3-methoxy-2-[2-[(4-phenoxy-1,3,5-triazin-2-yl)oxy]phenyl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1Oc1ncnc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H17N3O5/c1-25-12-16(18(24)26-2)15-10-6-7-11-17(15)28-20-22-13-21-19(23-20)27-14-8-4-3-5-9-14/h3-13H,1-2H3 |
| InChIKey | PPPFZHGCYZMQIT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|