C24H26N4O5 — CID 5085833
methyl 2-[2-[[4-(diethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy]phenyl]-3-methoxyprop-2-enoate (PubChem CID 5085833) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is methyl 2-[2-[[4-(diethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[4-(diethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 5085833 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | methyl 2-[2-[[4-(diethylamino)-6-phenoxy-1,3,5-triazin-2-yl]oxy]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCN(CC)c1nc(Oc2ccccc2)nc(Oc2ccccc2C(=COC)C(=O)OC)n1 |
| InChI | InChI=1S/C24H26N4O5/c1-5-28(6-2)22-25-23(32-17-12-8-7-9-13-17)27-24(26-22)33-20-15-11-10-14-18(20)19(16-30-3)21(29)31-4/h7-16H,5-6H2,1-4H3 |
| InChIKey | YVIFRWLXOPZWKG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|