C16H18N2O5 — CID 138476265
methyl (E)-3-methoxy-2-[2-[(5-propyl-1,3,4-oxadiazol-2-yl)oxy]phenyl]prop-2-enoate (PubChem CID 138476265) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl (E)-3-methoxy-2-[2-[(5-propyl-1,3,4-oxadiazol-2-yl)oxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-methoxy-2-[2-[(5-propyl-1,3,4-oxadiazol-2-yl)oxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 138476265 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl (E)-3-methoxy-2-[2-[(5-propyl-1,3,4-oxadiazol-2-yl)oxy]phenyl]prop-2-enoate |
| SMILES | CCCc1nnc(Oc2ccccc2/C(=C\OC)C(=O)OC)o1 |
| InChI | InChI=1S/C16H18N2O5/c1-4-7-14-17-18-16(23-14)22-13-9-6-5-8-11(13)12(10-20-2)15(19)21-3/h5-6,8-10H,4,7H2,1-3H3/b12-10+ |
| InChIKey | HFMDZSHFFYAPLM-ZRDIBKRKSA-N |
| XLogP | 2.97 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|