C17H17ClN2O3 — CID 135291891
methyl (E)-2-[2-[2-(6-chloropyrimidin-4-yl)ethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 135291891) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is methyl (E)-2-[2-[2-(6-chloropyrimidin-4-yl)ethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[2-(6-chloropyrimidin-4-yl)ethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 135291891 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl (E)-2-[2-[2-(6-chloropyrimidin-4-yl)ethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1CCc1cc(Cl)ncn1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-22-10-15(17(21)23-2)14-6-4-3-5-12(14)7-8-13-9-16(18)20-11-19-13/h3-6,9-11H,7-8H2,1-2H3/b15-10+ |
| InChIKey | BRLPTIINTVKHQZ-XNTDXEJSSA-N |
| XLogP | 3.08 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|