C31H36O5 — CID 134394757
5-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-tricyclo[4.3.1.13,8]undecanyl)phenoxy]pentanoic acid (PubChem CID 134394757) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is 5-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-tricyclo[4.3.1.13,8]undecanyl)phenoxy]pentanoic acid.
| Compound Name | 5-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-tricyclo[4.3.1.13,8]undecanyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 134394757 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 5-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-tricyclo[4.3.1.13,8]undecanyl)phenoxy]pentanoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2ccc(OCCCCC(=O)O)c(C34CCC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C31H36O5/c32-29(33)3-1-2-14-36-28-10-9-26(25-7-4-21(5-8-25)6-11-30(34)35)18-27(28)31-13-12-22-15-23(19-31)17-24(16-22)20-31/h4-11,18,22-24H,1-3,12-17,19-20H2,(H,32,33)(H,34,35)/b11-6+ |
| InChIKey | XLPLJHXWHOGNPJ-IZZDOVSWSA-N |
| XLogP | 6.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|