C26H30O3 — CID 134482664
(E)-3-[4-[3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid (PubChem CID 134482664) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is (E)-3-[4-[3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134482664 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (E)-3-[4-[3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
| SMILES | CC1CC2CC(C1)CC(C)(c1cc(-c3ccc(/C=C/C(=O)O)cc3)ccc1O)C2 |
| InChI | InChI=1S/C26H30O3/c1-17-11-19-13-20(12-17)16-26(2,15-19)23-14-22(8-9-24(23)27)21-6-3-18(4-7-21)5-10-25(28)29/h3-10,14,17,19-20,27H,11-13,15-16H2,1-2H3,(H,28,29)/b10-5+ |
| InChIKey | VSHURJNVENYXJM-BJMVGYQFSA-N |
| XLogP | 6.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|