C28H34O3 — CID 44569053
(E)-3-[4-[4-hydroxy-3-[(3R)-3-pentyl-1-bicyclo[2.2.2]octanyl]phenyl]phenyl]prop-2-enoic acid (PubChem CID 44569053) has the molecular formula C28H34O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is (E)-3-[4-[4-hydroxy-3-[(3R)-3-pentyl-1-bicyclo[2.2.2]octanyl]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-hydroxy-3-[(3R)-3-pentyl-1-bicyclo[2.2.2]octanyl]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 44569053 |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (E)-3-[4-[4-hydroxy-3-[(3R)-3-pentyl-1-bicyclo[2.2.2]octanyl]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCC[C@@H]1CC2(c3cc(-c4ccc(/C=C/C(=O)O)cc4)ccc3O)CCC1CC2 |
| InChI | InChI=1S/C28H34O3/c1-2-3-4-5-24-19-28(16-14-22(24)15-17-28)25-18-23(11-12-26(25)29)21-9-6-20(7-10-21)8-13-27(30)31/h6-13,18,22,24,29H,2-5,14-17,19H2,1H3,(H,30,31)/b13-8+/t22?,24-,28?/m1/s1 |
| InChIKey | SKYFOVJTZRLXIF-CIRPWULNSA-N |
| XLogP | 7.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|