C33H39NO5 — CID 46239562
(E)-3-[4-[3-(1-adamantyl)-4-(4-morpholin-4-ylbutanoyloxy)phenyl]phenyl]prop-2-enoic acid (PubChem CID 46239562) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is (E)-3-[4-[3-(1-adamantyl)-4-(4-morpholin-4-ylbutanoyloxy)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(1-adamantyl)-4-(4-morpholin-4-ylbutanoyloxy)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 46239562 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (E)-3-[4-[3-(1-adamantyl)-4-(4-morpholin-4-ylbutanoyloxy)phenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2ccc(OC(=O)CCCN3CCOCC3)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C33H39NO5/c35-31(36)10-5-23-3-6-27(7-4-23)28-8-9-30(39-32(37)2-1-11-34-12-14-38-15-13-34)29(19-28)33-20-24-16-25(21-33)18-26(17-24)22-33/h3-10,19,24-26H,1-2,11-18,20-22H2,(H,35,36)/b10-5+ |
| InChIKey | GEFCKJVNGMXTQZ-BJMVGYQFSA-N |
| XLogP | 5.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|