C27H29O3- — CID 54719348
2-(1-adamantyl)-4-[4-[(E)-2-carboxyethenyl]-2,6-dimethylphenyl]phenolate (PubChem CID 54719348) has the molecular formula C27H29O3- and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-[4-[(E)-2-carboxyethenyl]-2,6-dimethylphenyl]phenolate.
| Compound Name | 2-(1-adamantyl)-4-[4-[(E)-2-carboxyethenyl]-2,6-dimethylphenyl]phenolate |
|---|---|
| PubChem CID | 54719348 |
| Molecular Formula | C27H29O3- |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-(1-adamantyl)-4-[4-[(E)-2-carboxyethenyl]-2,6-dimethylphenyl]phenolate |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1-c1ccc([O-])c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C27H30O3/c1-16-7-18(3-6-25(29)30)8-17(2)26(16)22-4-5-24(28)23(12-22)27-13-19-9-20(14-27)11-21(10-19)15-27/h3-8,12,19-21,28H,9-11,13-15H2,1-2H3,(H,29,30)/p-1/b6-3+ |
| InChIKey | UPPRXNNCHKTPDT-ZZXKWVIFSA-M |
| XLogP | 5.61 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|