C20H23FO3 — CID 142736361
methyl (E)-3-[4-(1-adamantyl)-2-fluorophenoxy]prop-2-enoate (PubChem CID 142736361) has the molecular formula C20H23FO3 and a molecular weight of 330.40 g/mol. Its IUPAC name is methyl (E)-3-[4-(1-adamantyl)-2-fluorophenoxy]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(1-adamantyl)-2-fluorophenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 142736361 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl (E)-3-[4-(1-adamantyl)-2-fluorophenoxy]prop-2-enoate |
| SMILES | COC(=O)/C=C/Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C20H23FO3/c1-23-19(22)4-5-24-18-3-2-16(9-17(18)21)20-10-13-6-14(11-20)8-15(7-13)12-20/h2-5,9,13-15H,6-8,10-12H2,1H3/b5-4+ |
| InChIKey | BQMILVQDLYOELB-SNAWJCMRSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|