C21H23NO3 — CID 162458823
methyl 2-[5-(1-adamantyl)-1H-indol-3-yl]-2-oxoacetate (PubChem CID 162458823) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[5-(1-adamantyl)-1H-indol-3-yl]-2-oxoacetate.
| Compound Name | methyl 2-[5-(1-adamantyl)-1H-indol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 162458823 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl 2-[5-(1-adamantyl)-1H-indol-3-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c[nH]c2ccc(C34CC5CC(CC(C5)C3)C4)cc12 |
| InChI | InChI=1S/C21H23NO3/c1-25-20(24)19(23)17-11-22-18-3-2-15(7-16(17)18)21-8-12-4-13(9-21)6-14(5-12)10-21/h2-3,7,11-14,22H,4-6,8-10H2,1H3 |
| InChIKey | AYLQZHWMYZLAPU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|