C19H22F3NO — CID 91679525
N-[4-(1-adamantyl)-2-methylphenyl]-2,2,2-trifluoroacetamide (PubChem CID 91679525) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-2-methylphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(1-adamantyl)-2-methylphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91679525 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[4-(1-adamantyl)-2-methylphenyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(C23CC4CC(CC(C4)C2)C3)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H22F3NO/c1-11-4-15(2-3-16(11)23-17(24)19(20,21)22)18-8-12-5-13(9-18)7-14(6-12)10-18/h2-4,12-14H,5-10H2,1H3,(H,23,24) |
| InChIKey | XLEIYPIKSHSCCP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |