C22H23N5 — CID 168607732
2-[5-(1-adamantyl)-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607732) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-[5-(1-adamantyl)-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-(1-adamantyl)-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607732 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-[5-(1-adamantyl)-2-(methylamino)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CNc1ccc(C23CC4CC(CC(C4)C2)C3)cc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C22H23N5/c1-26-19-3-2-18(7-20(19)27-21(13-25)17(11-23)12-24)22-8-14-4-15(9-22)6-16(5-14)10-22/h2-3,7,14-16,26-27H,4-6,8-10H2,1H3 |
| InChIKey | XOMQPHGXNKXYPF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|