C24H27BrN2O — CID 91679538
N-[4-(1-adamantyl)-2-bromophenyl]-4-amino-3-methylbenzamide (PubChem CID 91679538) has the molecular formula C24H27BrN2O and a molecular weight of 439.40 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-2-bromophenyl]-4-amino-3-methylbenzamide.
| Compound Name | N-[4-(1-adamantyl)-2-bromophenyl]-4-amino-3-methylbenzamide |
|---|---|
| PubChem CID | 91679538 |
| Molecular Formula | C24H27BrN2O |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[4-(1-adamantyl)-2-bromophenyl]-4-amino-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2Br)ccc1N |
| InChI | InChI=1S/C24H27BrN2O/c1-14-6-18(2-4-21(14)26)23(28)27-22-5-3-19(10-20(22)25)24-11-15-7-16(12-24)9-17(8-15)13-24/h2-6,10,15-17H,7-9,11-13,26H2,1H3,(H,27,28) |
| InChIKey | YHPZUECOGGXBMM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|