C33H38N2O4 — CID 11670939
2-[6-[3-(1-adamantyl)-4-(1,2-dihydroxyethyl)phenyl]naphthalen-2-yl]-N,N'-dimethylpropanediamide (PubChem CID 11670939) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-[6-[3-(1-adamantyl)-4-(1,2-dihydroxyethyl)phenyl]naphthalen-2-yl]-N,N'-dimethylpropanediamide.
| Compound Name | 2-[6-[3-(1-adamantyl)-4-(1,2-dihydroxyethyl)phenyl]naphthalen-2-yl]-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 11670939 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 2-[6-[3-(1-adamantyl)-4-(1,2-dihydroxyethyl)phenyl]naphthalen-2-yl]-N,N'-dimethylpropanediamide |
| SMILES | CNC(=O)C(C(=O)NC)c1ccc2cc(-c3ccc(C(O)CO)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C33H38N2O4/c1-34-31(38)30(32(39)35-2)26-6-5-22-12-23(3-4-24(22)13-26)25-7-8-27(29(37)18-36)28(14-25)33-15-19-9-20(16-33)11-21(10-19)17-33/h3-8,12-14,19-21,29-30,36-37H,9-11,15-18H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | CNTUGJWSSPMIOO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|