C25H28N2O3 — CID 11545898
2-[6-(4-methoxy-3-propan-2-ylphenyl)naphthalen-2-yl]-N,N'-dimethylpropanediamide (PubChem CID 11545898) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[6-(4-methoxy-3-propan-2-ylphenyl)naphthalen-2-yl]-N,N'-dimethylpropanediamide.
| Compound Name | 2-[6-(4-methoxy-3-propan-2-ylphenyl)naphthalen-2-yl]-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 11545898 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[6-(4-methoxy-3-propan-2-ylphenyl)naphthalen-2-yl]-N,N'-dimethylpropanediamide |
| SMILES | CNC(=O)C(C(=O)NC)c1ccc2cc(-c3ccc(OC)c(C(C)C)c3)ccc2c1 |
| InChI | InChI=1S/C25H28N2O3/c1-15(2)21-14-19(10-11-22(21)30-5)17-6-7-18-13-20(9-8-16(18)12-17)23(24(28)26-3)25(29)27-4/h6-15,23H,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | QSKHFQSHDXURPU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|