C23H18O5 — CID 143134506
3-[6-(4-methoxy-3-methylphenyl)naphthalen-2-yl]-2,4-dioxopentanedial (PubChem CID 143134506) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-[6-(4-methoxy-3-methylphenyl)naphthalen-2-yl]-2,4-dioxopentanedial.
| Compound Name | 3-[6-(4-methoxy-3-methylphenyl)naphthalen-2-yl]-2,4-dioxopentanedial |
|---|---|
| PubChem CID | 143134506 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-[6-(4-methoxy-3-methylphenyl)naphthalen-2-yl]-2,4-dioxopentanedial |
| SMILES | COc1ccc(-c2ccc3cc(C(C(=O)C=O)C(=O)C=O)ccc3c2)cc1C |
| InChI | InChI=1S/C23H18O5/c1-14-9-15(7-8-22(14)28-2)16-3-4-18-11-19(6-5-17(18)10-16)23(20(26)12-24)21(27)13-25/h3-13,23H,1-2H3 |
| InChIKey | GBWKZNCMGAWOFT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|