C37H42O6 — CID 145418893
2-methoxy-6-[4-[2-(4-methoxyphenoxy)ethoxy]-3-methylphenyl]naphthalene;3-methyl-2-methylidenebutanal;2-methylprop-2-enal (PubChem CID 145418893) has the molecular formula C37H42O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is 2-methoxy-6-[4-[2-(4-methoxyphenoxy)ethoxy]-3-methylphenyl]naphthalene;3-methyl-2-methylidenebutanal;2-methylprop-2-enal.
| Compound Name | 2-methoxy-6-[4-[2-(4-methoxyphenoxy)ethoxy]-3-methylphenyl]naphthalene;3-methyl-2-methylidenebutanal;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145418893 |
| Molecular Formula | C37H42O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 2-methoxy-6-[4-[2-(4-methoxyphenoxy)ethoxy]-3-methylphenyl]naphthalene;3-methyl-2-methylidenebutanal;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C(C=O)C(C)C.COc1ccc(OCCOc2ccc(-c3ccc4cc(OC)ccc4c3)cc2C)cc1 |
| InChI | InChI=1S/C27H26O4.C6H10O.C4H6O/c1-19-16-20(21-4-5-23-18-26(29-3)8-6-22(23)17-21)7-13-27(19)31-15-14-30-25-11-9-24(28-2)10-12-25;1-5(2)6(3)4-7;1-4(2)3-5/h4-13,16-18H,14-15H2,1-3H3;4-5H,3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | UDXPOOHVDNAARS-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|