C46H34N2O10 — CID 101072349
2-[4-[4-(1-adamantyl)-3-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 101072349) has the molecular formula C46H34N2O10 and a molecular weight of 774.78 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)-3-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-[4-(1-adamantyl)-3-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 101072349 |
| Molecular Formula | C46H34N2O10 |
| Molecular Weight | 774.78 g/mol |
| Exact Mass | 774.22 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)-3-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(Oc3ccc(C45CC6CC(CC(C6)C4)C5)c(Oc4ccc(N5C(=O)c6ccc(C(=O)O)cc6C5=O)cc4)c3)cc1)C2=O |
| InChI | InChI=1S/C46H34N2O10/c49-40-34-12-1-27(44(53)54)18-36(34)42(51)47(40)29-3-7-31(8-4-29)57-33-11-14-38(46-21-24-15-25(22-46)17-26(16-24)23-46)39(20-33)58-32-9-5-30(6-10-32)48-41(50)35-13-2-28(45(55)56)19-37(35)43(48)52/h1-14,18-20,24-26H,15-17,21-23H2,(H,53,54)(H,55,56) |
| InChIKey | HPAUISYQUVPJNS-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.78 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide_misc(2)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|