C38H40N2O6 — CID 86623821
1-[5-(1-adamantyl)-2,4-bis(4-nitrophenoxy)phenyl]adamantane (PubChem CID 86623821) has the molecular formula C38H40N2O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is 1-[5-(1-adamantyl)-2,4-bis(4-nitrophenoxy)phenyl]adamantane.
| Compound Name | 1-[5-(1-adamantyl)-2,4-bis(4-nitrophenoxy)phenyl]adamantane |
|---|---|
| PubChem CID | 86623821 |
| Molecular Formula | C38H40N2O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 1-[5-(1-adamantyl)-2,4-bis(4-nitrophenoxy)phenyl]adamantane |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(Oc3ccc([N+](=O)[O-])cc3)c(C34CC5CC(CC(C5)C3)C4)cc2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C38H40N2O6/c41-39(42)29-1-5-31(6-2-29)45-35-16-36(46-32-7-3-30(4-8-32)40(43)44)34(38-20-26-12-27(21-38)14-28(13-26)22-38)15-33(35)37-17-23-9-24(18-37)11-25(10-23)19-37/h1-8,15-16,23-28H,9-14,17-22H2 |
| InChIKey | ZQIRYYLSZVFLPB-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|