C28H26N2O6 — CID 151477312
2-[2,3-bis(4-nitrophenoxy)phenyl]adamantane (PubChem CID 151477312) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[2,3-bis(4-nitrophenoxy)phenyl]adamantane.
| Compound Name | 2-[2,3-bis(4-nitrophenoxy)phenyl]adamantane |
|---|---|
| PubChem CID | 151477312 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[2,3-bis(4-nitrophenoxy)phenyl]adamantane |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(C3C4CC5CC(C4)CC3C5)c2Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H26N2O6/c31-29(32)21-4-8-23(9-5-21)35-26-3-1-2-25(27-19-13-17-12-18(15-19)16-20(27)14-17)28(26)36-24-10-6-22(7-11-24)30(33)34/h1-11,17-20,27H,12-16H2 |
| InChIKey | PLSMEMSDMIQCNG-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|