C34H29N2O6P — CID 142681923
1-[4-[2,3-bis(3-nitrophenyl)-4-phosphorosophenoxy]phenyl]adamantane (PubChem CID 142681923) has the molecular formula C34H29N2O6P and a molecular weight of 592.59 g/mol. Its IUPAC name is 1-[4-[2,3-bis(3-nitrophenyl)-4-phosphorosophenoxy]phenyl]adamantane.
| Compound Name | 1-[4-[2,3-bis(3-nitrophenyl)-4-phosphorosophenoxy]phenyl]adamantane |
|---|---|
| PubChem CID | 142681923 |
| Molecular Formula | C34H29N2O6P |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 1-[4-[2,3-bis(3-nitrophenyl)-4-phosphorosophenoxy]phenyl]adamantane |
| SMILES | O=Pc1ccc(Oc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(-c2cccc([N+](=O)[O-])c2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H29N2O6P/c37-35(38)27-5-1-3-24(16-27)32-30(11-12-31(43-41)33(32)25-4-2-6-28(17-25)36(39)40)42-29-9-7-26(8-10-29)34-18-21-13-22(19-34)15-23(14-21)20-34/h1-12,16-17,21-23H,13-15,18-20H2 |
| InChIKey | WJKDQBBODISVQV-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|