C28H24O12 — CID 21388913
6-[3-(2,3,5-tricarboxyphenyl)-1-adamantyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 21388913) has the molecular formula C28H24O12 and a molecular weight of 552.49 g/mol. Its IUPAC name is 6-[3-(2,3,5-tricarboxyphenyl)-1-adamantyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 6-[3-(2,3,5-tricarboxyphenyl)-1-adamantyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 21388913 |
| Molecular Formula | C28H24O12 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 6-[3-(2,3,5-tricarboxyphenyl)-1-adamantyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)O)c(C23CC4CC(C2)CC(c2cc(C(=O)O)cc(C(=O)O)c2C(=O)O)(C4)C3)c1 |
| InChI | InChI=1S/C28H24O12/c29-21(30)13-2-15(23(33)34)19(25(37)38)17(4-13)27-6-11-1-12(7-27)9-28(8-11,10-27)18-5-14(22(31)32)3-16(24(35)36)20(18)26(39)40/h2-5,11-12H,1,6-10H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | OZSQWTZCYAPZSN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |