C28H35NO2 — CID 132947601
N-[4-(1-adamantyl)phenyl]-2-(2-propan-2-ylphenoxy)propanamide (PubChem CID 132947601) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-(2-propan-2-ylphenoxy)propanamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-(2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 132947601 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-(2-propan-2-ylphenoxy)propanamide |
| SMILES | CC(Oc1ccccc1C(C)C)C(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H35NO2/c1-18(2)25-6-4-5-7-26(25)31-19(3)27(30)29-24-10-8-23(9-11-24)28-15-20-12-21(16-28)14-22(13-20)17-28/h4-11,18-22H,12-17H2,1-3H3,(H,29,30) |
| InChIKey | FLUZTGGPGKCJSR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |